C34H42N8O3 — CID 66630748
N-[(1S,2R,3S,4R)-4-[2-[2-(cyclohexylmethylidene)hydrazinyl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 66630748) has the molecular formula C34H42N8O3 and a molecular weight of 610.76 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-[2-(cyclohexylmethylidene)hydrazinyl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-[2-(cyclohexylmethylidene)hydrazinyl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 66630748 |
| Molecular Formula | C34H42N8O3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-[2-(cyclohexylmethylidene)hydrazinyl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NN=CC4CCCCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H42N8O3/c1-2-28(43)38-26-18-27(31(45)30(26)44)42-21-36-29-32(39-34(40-33(29)42)41-37-19-22-12-6-3-7-13-22)35-20-25(23-14-8-4-9-15-23)24-16-10-5-11-17-24/h4-5,8-11,14-17,19,21-22,25-27,30-31,44-45H,2-3,6-7,12-13,18,20H2,1H3,(H,38,43)(H2,35,39,40,41)/t26-,27+,30+,31-/m0/s1 |
| InChIKey | JVPSXNBDPBFNED-WFFVHEBKSA-N |
| XLogP | 4.61 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|