C30H32N6O5 — CID 68960915
9-[(1R,2S,3R,4S)-4-(cyclobutanecarbonylamino)-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylic acid (PubChem CID 68960915) has the molecular formula C30H32N6O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is 9-[(1R,2S,3R,4S)-4-(cyclobutanecarbonylamino)-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylic acid.
| Compound Name | 9-[(1R,2S,3R,4S)-4-(cyclobutanecarbonylamino)-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylic acid |
|---|---|
| PubChem CID | 68960915 |
| Molecular Formula | C30H32N6O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 9-[(1R,2S,3R,4S)-4-(cyclobutanecarbonylamino)-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3C[C@H](NC(=O)C4CCC4)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C30H32N6O5/c37-24-21(33-29(39)19-12-7-13-19)14-22(25(24)38)36-16-32-23-26(34-27(30(40)41)35-28(23)36)31-15-20(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,16,19-22,24-25,37-38H,7,12-15H2,(H,33,39)(H,40,41)(H,31,34,35)/t21-,22+,24+,25-/m0/s1 |
| InChIKey | UCLUZDWOINUOCR-AICRDVKUSA-N |
| XLogP | 2.72 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |