C26H28N6O4 — CID 66630908
methyl 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylate (PubChem CID 66630908) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is methyl 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylate.
| Compound Name | methyl 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylate |
|---|---|
| PubChem CID | 66630908 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | methyl 9-[(1R,2S,3R,4S)-4-amino-2,3-dihydroxycyclopentyl]-6-(2,2-diphenylethylamino)purine-2-carboxylate |
| SMILES | COC(=O)c1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3C[C@H](N)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C26H28N6O4/c1-36-26(35)24-30-23(20-25(31-24)32(14-29-20)19-12-18(27)21(33)22(19)34)28-13-17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17-19,21-22,33-34H,12-13,27H2,1H3,(H,28,30,31)/t18-,19+,21+,22-/m0/s1 |
| InChIKey | BKKXHWDNMICARJ-PSBKLILYSA-N |
| XLogP | 1.85 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |