C31H37FN8O3 — CID 68916532
N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2-(4-fluorophenyl)-2-phenylethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 68916532) has the molecular formula C31H37FN8O3 and a molecular weight of 588.69 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2-(4-fluorophenyl)-2-phenylethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2-(4-fluorophenyl)-2-phenylethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 68916532 |
| Molecular Formula | C31H37FN8O3 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-[[2-(4-fluorophenyl)-2-phenylethyl]amino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccc(F)cc4)nc(N4CC[C@@H](N)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H37FN8O3/c1-2-25(41)36-23-14-24(28(43)27(23)42)40-17-35-26-29(37-31(38-30(26)40)39-13-12-21(33)16-39)34-15-22(18-6-4-3-5-7-18)19-8-10-20(32)11-9-19/h3-11,17,21-24,27-28,42-43H,2,12-16,33H2,1H3,(H,36,41)(H,34,37,38)/t21-,22?,23+,24-,27-,28+/m1/s1 |
| InChIKey | BOEMECAQULLGDA-LBLMZHHOSA-N |
| XLogP | 2.31 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |