C31H38N8O5 — CID 66630816
N-[(1S,2R,3S,4R)-4-[2-(3-aminopyrrolidin-1-yl)-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 66630816) has the molecular formula C31H38N8O5 and a molecular weight of 602.70 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-(3-aminopyrrolidin-1-yl)-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-(3-aminopyrrolidin-1-yl)-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 66630816 |
| Molecular Formula | C31H38N8O5 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-(3-aminopyrrolidin-1-yl)-6-[2,2-bis(4-hydroxyphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccc(O)cc4)c4ccc(O)cc4)nc(N4CCC(N)C4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H38N8O5/c1-2-25(42)35-23-13-24(28(44)27(23)43)39-16-34-26-29(36-31(37-30(26)39)38-12-11-19(32)15-38)33-14-22(17-3-7-20(40)8-4-17)18-5-9-21(41)10-6-18/h3-10,16,19,22-24,27-28,40-41,43-44H,2,11-15,32H2,1H3,(H,35,42)(H,33,36,37)/t19?,23-,24+,27+,28-/m0/s1 |
| InChIKey | MHDPDYLCUCQPLP-ABYMFODYSA-N |
| XLogP | 1.58 |
| TPSA | 194.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |