C33H40N8O3 — CID 67019351
N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]cyclobutanecarboxamide (PubChem CID 67019351) has the molecular formula C33H40N8O3 and a molecular weight of 596.74 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]cyclobutanecarboxamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 67019351 |
| Molecular Formula | C33H40N8O3 |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-[(3R)-3-aminopyrrolidin-1-yl]-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]cyclobutanecarboxamide |
| SMILES | N[C@@H]1CCN(c2nc(NCC(c3ccccc3)c3ccccc3)c3ncn([C@@H]4C[C@H](NC(=O)C5CCC5)[C@@H](O)[C@H]4O)c3n2)C1 |
| InChI | InChI=1S/C33H40N8O3/c34-23-14-15-40(18-23)33-38-30(35-17-24(20-8-3-1-4-9-20)21-10-5-2-6-11-21)27-31(39-33)41(19-36-27)26-16-25(28(42)29(26)43)37-32(44)22-12-7-13-22/h1-6,8-11,19,22-26,28-29,42-43H,7,12-18,34H2,(H,37,44)(H,35,38,39)/t23-,25+,26-,28-,29+/m1/s1 |
| InChIKey | IEINBDSPHGZMNI-HAXKFQDESA-N |
| XLogP | 2.56 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |