C24H27Cl3N6O2 — CID 87088530
(1R,2R,3R,5R)-3-amino-5-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]cyclopentane-1,2-diol;dihydrochloride (PubChem CID 87088530) has the molecular formula C24H27Cl3N6O2 and a molecular weight of 537.88 g/mol. Its IUPAC name is (1R,2R,3R,5R)-3-amino-5-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]cyclopentane-1,2-diol;dihydrochloride.
| Compound Name | (1R,2R,3R,5R)-3-amino-5-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]cyclopentane-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 87088530 |
| Molecular Formula | C24H27Cl3N6O2 |
| Molecular Weight | 537.88 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (1R,2R,3R,5R)-3-amino-5-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]cyclopentane-1,2-diol;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(Cl)nc32)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H25ClN6O2.2ClH/c25-24-29-22(19-23(30-24)31(13-28-19)18-11-17(26)20(32)21(18)33)27-12-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15;;/h1-10,13,16-18,20-21,32-33H,11-12,26H2,(H,27,29,30);2*1H/t17-,18-,20-,21-;;/m1../s1 |
| InChIKey | ZCXYUWQRFFQOAN-RTIZHJTNSA-N |
| XLogP | 3.56 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |