C28H29ClN6O7 — CID 86647545
[2-[[(1S,2R,3S,4R)-4-[6-[2,2-bis(4-hydroxyphenyl)ethylamino]-2-chloropurin-9-yl]-2,3-dihydroxycyclopentyl]amino]-2-oxoethyl] acetate (PubChem CID 86647545) has the molecular formula C28H29ClN6O7 and a molecular weight of 597.03 g/mol. Its IUPAC name is [2-[[(1S,2R,3S,4R)-4-[6-[2,2-bis(4-hydroxyphenyl)ethylamino]-2-chloropurin-9-yl]-2,3-dihydroxycyclopentyl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[(1S,2R,3S,4R)-4-[6-[2,2-bis(4-hydroxyphenyl)ethylamino]-2-chloropurin-9-yl]-2,3-dihydroxycyclopentyl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 86647545 |
| Molecular Formula | C28H29ClN6O7 |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | [2-[[(1S,2R,3S,4R)-4-[6-[2,2-bis(4-hydroxyphenyl)ethylamino]-2-chloropurin-9-yl]-2,3-dihydroxycyclopentyl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccc(O)cc4)c4ccc(O)cc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H29ClN6O7/c1-14(36)42-12-22(39)32-20-10-21(25(41)24(20)40)35-13-31-23-26(33-28(29)34-27(23)35)30-11-19(15-2-6-17(37)7-3-15)16-4-8-18(38)9-5-16/h2-9,13,19-21,24-25,37-38,40-41H,10-12H2,1H3,(H,32,39)(H,30,33,34)/t20-,21+,24+,25-/m0/s1 |
| InChIKey | DQHOZEAZBNZUMD-JMLJLYKJSA-N |
| XLogP | 1.85 |
| TPSA | 191.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |