C28H31ClN6O3 — CID 86622642
N-[(1S,2R,3S,4R)-4-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide (PubChem CID 86622642) has the molecular formula C28H31ClN6O3 and a molecular weight of 535.05 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide |
|---|---|
| PubChem CID | 86622642 |
| Molecular Formula | C28H31ClN6O3 |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-chloro-6-(2,2-diphenylethylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide |
| SMILES | CCCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H31ClN6O3/c1-2-9-22(36)32-20-14-21(25(38)24(20)37)35-16-31-23-26(33-28(29)34-27(23)35)30-15-19(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,16,19-21,24-25,37-38H,2,9,14-15H2,1H3,(H,32,36)(H,30,33,34)/t20-,21+,24+,25-/m0/s1 |
| InChIKey | WTBFFQADNOOTDX-JMLJLYKJSA-N |
| XLogP | 3.68 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |