C33H38N6O3 — CID 67019346
N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-hex-1-ynylpurin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 67019346) has the molecular formula C33H38N6O3 and a molecular weight of 566.71 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-hex-1-ynylpurin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-hex-1-ynylpurin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 67019346 |
| Molecular Formula | C33H38N6O3 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-hex-1-ynylpurin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCCCC#Cc1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3C[C@H](NC(=O)CC)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C33H38N6O3/c1-3-5-6-13-18-27-37-32(34-20-24(22-14-9-7-10-15-22)23-16-11-8-12-17-23)29-33(38-27)39(21-35-29)26-19-25(30(41)31(26)42)36-28(40)4-2/h7-12,14-17,21,24-26,30-31,41-42H,3-6,19-20H2,1-2H3,(H,36,40)(H,34,37,38)/t25-,26+,30+,31-/m0/s1 |
| InChIKey | OPIDDQIJPDQEBT-ZBKRMGPDSA-N |
| XLogP | 4.17 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|