C13H15Cl2N5O3 — CID 86622629
N-[(1S,2R,3S,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 86622629) has the molecular formula C13H15Cl2N5O3 and a molecular weight of 360.20 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 86622629 |
| Molecular Formula | C13H15Cl2N5O3 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-(2,6-dichloropurin-9-yl)-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(Cl)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15Cl2N5O3/c1-2-7(21)17-5-3-6(10(23)9(5)22)20-4-16-8-11(14)18-13(15)19-12(8)20/h4-6,9-10,22-23H,2-3H2,1H3,(H,17,21)/t5-,6+,9+,10-/m0/s1 |
| InChIKey | NMLBBLKBSDDLBB-ZRVLKLQWSA-N |
| XLogP | 0.69 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |