C21H26ClN7O5S — CID 24898400
N-[(1S,2R,3S,4R)-4-[2-chloro-6-[2-(4-sulfamoylphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 24898400) has the molecular formula C21H26ClN7O5S and a molecular weight of 524.00 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[2-chloro-6-[2-(4-sulfamoylphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[2-chloro-6-[2-(4-sulfamoylphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 24898400 |
| Molecular Formula | C21H26ClN7O5S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[2-chloro-6-[2-(4-sulfamoylphenyl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCCc4ccc(S(N)(=O)=O)cc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H26ClN7O5S/c1-2-15(30)26-13-9-14(18(32)17(13)31)29-10-25-16-19(27-21(22)28-20(16)29)24-8-7-11-3-5-12(6-4-11)35(23,33)34/h3-6,10,13-14,17-18,31-32H,2,7-9H2,1H3,(H,26,30)(H2,23,33,34)(H,24,27,28)/t13-,14+,17+,18-/m0/s1 |
| InChIKey | UMNFJBJXCBRRKD-JFTQMJAMSA-N |
| XLogP | 0.34 |
| TPSA | 185.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |