C25H42N8O3 — CID 24771617
N-[(1S,2R,3S)-4-[2-[(4-aminocyclohexyl)amino]-6-(3,3-dimethylbutylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 24771617) has the molecular formula C25H42N8O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-[(1S,2R,3S)-4-[2-[(4-aminocyclohexyl)amino]-6-(3,3-dimethylbutylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[(1S,2R,3S)-4-[2-[(4-aminocyclohexyl)amino]-6-(3,3-dimethylbutylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 24771617 |
| Molecular Formula | C25H42N8O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | N-[(1S,2R,3S)-4-[2-[(4-aminocyclohexyl)amino]-6-(3,3-dimethylbutylamino)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)N[C@H]1CC(n2cnc3c(NCCC(C)(C)C)nc(NC4CCC(N)CC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H42N8O3/c1-5-18(34)30-16-12-17(21(36)20(16)35)33-13-28-19-22(27-11-10-25(2,3)4)31-24(32-23(19)33)29-15-8-6-14(26)7-9-15/h13-17,20-21,35-36H,5-12,26H2,1-4H3,(H,30,34)(H2,27,29,31,32)/t14?,15?,16-,17?,20+,21-/m0/s1 |
| InChIKey | RUVIVIRIBWFINB-XPXCCGEHSA-N |
| XLogP | 1.92 |
| TPSA | 163.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |