C22H39Cl2N7 — CID 18473399
2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-hexylpurine-2,6-diamine;dihydrochloride (PubChem CID 18473399) has the molecular formula C22H39Cl2N7 and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-hexylpurine-2,6-diamine;dihydrochloride.
| Compound Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-hexylpurine-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18473399 |
| Molecular Formula | C22H39Cl2N7 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-hexylpurine-2,6-diamine;dihydrochloride |
| SMILES | CCCCCCNc1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCCC1.Cl.Cl |
| InChI | InChI=1S/C22H37N7.2ClH/c1-2-3-4-7-14-24-20-19-21(29(15-25-19)18-8-5-6-9-18)28-22(27-20)26-17-12-10-16(23)11-13-17;;/h15-18H,2-14,23H2,1H3,(H2,24,26,27,28);2*1H |
| InChIKey | KOQDEGHWASLJDM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|