C26H42N8O3 — CID 69020294
[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl] butyl carbonate (PubChem CID 69020294) has the molecular formula C26H42N8O3 and a molecular weight of 514.68 g/mol. Its IUPAC name is [4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl] butyl carbonate.
| Compound Name | [4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl] butyl carbonate |
|---|---|
| PubChem CID | 69020294 |
| Molecular Formula | C26H42N8O3 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | [4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl] butyl carbonate |
| SMILES | CCCCOC(=O)ON1CCC(Nc2nc(NC3CCC(N)CC3)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C26H42N8O3/c1-2-3-16-36-26(35)37-33-14-12-20(13-15-33)29-23-22-24(34(17-28-22)21-6-4-5-7-21)32-25(31-23)30-19-10-8-18(27)9-11-19/h17-21H,2-16,27H2,1H3,(H2,29,30,31,32) |
| InChIKey | ZGTIQODMTDZMCV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|