C27H45N9O — CID 69020100
4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]-N-pentylpiperidine-1-carboxamide (PubChem CID 69020100) has the molecular formula C27H45N9O and a molecular weight of 511.72 g/mol. Its IUPAC name is 4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]-N-pentylpiperidine-1-carboxamide.
| Compound Name | 4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]-N-pentylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 69020100 |
| Molecular Formula | C27H45N9O |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | 4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]-N-pentylpiperidine-1-carboxamide |
| SMILES | CCCCCNC(=O)N1CCC(Nc2nc(NC3CCC(N)CC3)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C27H45N9O/c1-2-3-6-15-29-27(37)35-16-13-21(14-17-35)31-24-23-25(36(18-30-23)22-7-4-5-8-22)34-26(33-24)32-20-11-9-19(28)10-12-20/h18-22H,2-17,28H2,1H3,(H,29,37)(H2,31,32,33,34) |
| InChIKey | PUXDCKXJLCAGFK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|