C25H40Cl2N8O — CID 69019122
1-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]but-2-en-1-one;dihydrochloride (PubChem CID 69019122) has the molecular formula C25H40Cl2N8O and a molecular weight of 539.56 g/mol. Its IUPAC name is 1-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]but-2-en-1-one;dihydrochloride.
| Compound Name | 1-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]but-2-en-1-one;dihydrochloride |
|---|---|
| PubChem CID | 69019122 |
| Molecular Formula | C25H40Cl2N8O |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 1-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]but-2-en-1-one;dihydrochloride |
| SMILES | CC=CC(=O)N1CCC(Nc2nc(NC3CCC(N)CC3)nc3c2ncn3C2CCCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C25H38N8O.2ClH/c1-2-5-21(34)32-14-12-19(13-15-32)28-23-22-24(33(16-27-22)20-6-3-4-7-20)31-25(30-23)29-18-10-8-17(26)9-11-18;;/h2,5,16-20H,3-4,6-15,26H2,1H3,(H2,28,29,30,31);2*1H |
| InChIKey | GRKPYTLESBZYFA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|