C26H40N8O3 — CID 10121127
ethyl 3-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]-3-oxopropanoate (PubChem CID 10121127) has the molecular formula C26H40N8O3 and a molecular weight of 512.66 g/mol. Its IUPAC name is ethyl 3-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 10121127 |
| Molecular Formula | C26H40N8O3 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | ethyl 3-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1CCC(Nc2nc(NC3CCC(N)CC3)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C26H40N8O3/c1-2-37-22(36)15-21(35)33-13-11-19(12-14-33)29-24-23-25(34(16-28-23)20-5-3-4-6-20)32-26(31-24)30-18-9-7-17(27)8-10-18/h16-20H,2-15,27H2,1H3,(H2,29,30,31,32) |
| InChIKey | DUDMWCRDTHHHGG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|