C27H46N8O — CID 10195908
2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[1-(4-ethoxybutyl)piperidin-4-yl]purine-2,6-diamine (PubChem CID 10195908) has the molecular formula C27H46N8O and a molecular weight of 498.72 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[1-(4-ethoxybutyl)piperidin-4-yl]purine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[1-(4-ethoxybutyl)piperidin-4-yl]purine-2,6-diamine |
|---|---|
| PubChem CID | 10195908 |
| Molecular Formula | C27H46N8O |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.38 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[1-(4-ethoxybutyl)piperidin-4-yl]purine-2,6-diamine |
| SMILES | CCOCCCCN1CCC(Nc2nc(NC3CCC(N)CC3)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C27H46N8O/c1-2-36-18-6-5-15-34-16-13-22(14-17-34)30-25-24-26(35(19-29-24)23-7-3-4-8-23)33-27(32-25)31-21-11-9-20(28)10-12-21/h19-23H,2-18,28H2,1H3,(H2,30,31,32,33) |
| InChIKey | JMEFRUCMGKLSQO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|