C33H50N8O — CID 10153104
6-N-(4-aminocyclohexyl)-9-cyclopentyl-2-N-[1-[4-(2-phenylethoxy)butyl]piperidin-4-yl]purine-2,6-diamine (PubChem CID 10153104) has the molecular formula C33H50N8O and a molecular weight of 574.82 g/mol. Its IUPAC name is 6-N-(4-aminocyclohexyl)-9-cyclopentyl-2-N-[1-[4-(2-phenylethoxy)butyl]piperidin-4-yl]purine-2,6-diamine.
| Compound Name | 6-N-(4-aminocyclohexyl)-9-cyclopentyl-2-N-[1-[4-(2-phenylethoxy)butyl]piperidin-4-yl]purine-2,6-diamine |
|---|---|
| PubChem CID | 10153104 |
| Molecular Formula | C33H50N8O |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | 6-N-(4-aminocyclohexyl)-9-cyclopentyl-2-N-[1-[4-(2-phenylethoxy)butyl]piperidin-4-yl]purine-2,6-diamine |
| SMILES | NC1CCC(Nc2nc(NC3CCN(CCCCOCCc4ccccc4)CC3)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C33H50N8O/c34-26-12-14-27(15-13-26)36-31-30-32(41(24-35-30)29-10-4-5-11-29)39-33(38-31)37-28-16-20-40(21-17-28)19-6-7-22-42-23-18-25-8-2-1-3-9-25/h1-3,8-9,24,26-29H,4-7,10-23,34H2,(H2,36,37,38,39) |
| InChIKey | MIFQWLGUFGTJSR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|