C34H52N8O — CID 18002188
2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(6-phenylmethoxyhexyl)piperidin-1-yl]purine-2,6-diamine (PubChem CID 18002188) has the molecular formula C34H52N8O and a molecular weight of 588.85 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(6-phenylmethoxyhexyl)piperidin-1-yl]purine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(6-phenylmethoxyhexyl)piperidin-1-yl]purine-2,6-diamine |
|---|---|
| PubChem CID | 18002188 |
| Molecular Formula | C34H52N8O |
| Molecular Weight | 588.85 g/mol |
| Exact Mass | 588.43 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(6-phenylmethoxyhexyl)piperidin-1-yl]purine-2,6-diamine |
| SMILES | NC1CCC(Nc2nc(NN3CCC(CCCCCCOCc4ccccc4)CC3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C34H52N8O/c35-28-15-17-29(18-16-28)37-34-38-32(31-33(39-34)42(25-36-31)30-13-7-8-14-30)40-41-21-19-26(20-22-41)10-4-1-2-9-23-43-24-27-11-5-3-6-12-27/h3,5-6,11-12,25-26,28-30H,1-2,4,7-10,13-24,35H2,(H2,37,38,39,40) |
| InChIKey | PUCLOAQXAUWJIG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.85 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|