C28H38N8 — CID 22563881
2-N-(4-aminocyclohexyl)-6-N-(4-benzylpiperidin-1-yl)-9-cyclopent-2-en-1-ylpurine-2,6-diamine (PubChem CID 22563881) has the molecular formula C28H38N8 and a molecular weight of 486.67 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-(4-benzylpiperidin-1-yl)-9-cyclopent-2-en-1-ylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-(4-benzylpiperidin-1-yl)-9-cyclopent-2-en-1-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 22563881 |
| Molecular Formula | C28H38N8 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-(4-benzylpiperidin-1-yl)-9-cyclopent-2-en-1-ylpurine-2,6-diamine |
| SMILES | NC1CCC(Nc2nc(NN3CCC(Cc4ccccc4)CC3)c3ncn(C4C=CCC4)c3n2)CC1 |
| InChI | InChI=1S/C28H38N8/c29-22-10-12-23(13-11-22)31-28-32-26(25-27(33-28)36(19-30-25)24-8-4-5-9-24)34-35-16-14-21(15-17-35)18-20-6-2-1-3-7-20/h1-4,6-8,19,21-24H,5,9-18,29H2,(H2,31,32,33,34) |
| InChIKey | AHDZFONCEQQIGE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|