C21H29N7 — CID 18473319
2-N-(4-aminocyclohexyl)-6-N-benzyl-9-propylpurine-2,6-diamine (PubChem CID 18473319) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-benzyl-9-propylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-benzyl-9-propylpurine-2,6-diamine |
|---|---|
| PubChem CID | 18473319 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-benzyl-9-propylpurine-2,6-diamine |
| SMILES | CCCn1cnc2c(NCc3ccccc3)nc(NC3CCC(N)CC3)nc21 |
| InChI | InChI=1S/C21H29N7/c1-2-12-28-14-24-18-19(23-13-15-6-4-3-5-7-15)26-21(27-20(18)28)25-17-10-8-16(22)9-11-17/h3-7,14,16-17H,2,8-13,22H2,1H3,(H2,23,25,26,27) |
| InChIKey | MPCZZUFRLPPLPQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |