C23H30FN7 — CID 69348559
2-N-[(1R,3S)-4-amino-3-fluorocyclohexyl]-6-N-benzyl-9-cyclopentylpurine-2,6-diamine (PubChem CID 69348559) has the molecular formula C23H30FN7 and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-N-[(1R,3S)-4-amino-3-fluorocyclohexyl]-6-N-benzyl-9-cyclopentylpurine-2,6-diamine.
| Compound Name | 2-N-[(1R,3S)-4-amino-3-fluorocyclohexyl]-6-N-benzyl-9-cyclopentylpurine-2,6-diamine |
|---|---|
| PubChem CID | 69348559 |
| Molecular Formula | C23H30FN7 |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 2-N-[(1R,3S)-4-amino-3-fluorocyclohexyl]-6-N-benzyl-9-cyclopentylpurine-2,6-diamine |
| SMILES | NC1CC[C@@H](Nc2nc(NCc3ccccc3)c3ncn(C4CCCC4)c3n2)C[C@@H]1F |
| InChI | InChI=1S/C23H30FN7/c24-18-12-16(10-11-19(18)25)28-23-29-21(26-13-15-6-2-1-3-7-15)20-22(30-23)31(14-27-20)17-8-4-5-9-17/h1-3,6-7,14,16-19H,4-5,8-13,25H2,(H2,26,28,29,30)/t16-,18+,19?/m1/s1 |
| InChIKey | LTFAQETWMJPNII-FAZYOCGDSA-N |
| XLogP | 4.18 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |