C29H37N9 — CID 144680088
2-N-(4-amino-3-methylcyclohexyl)-6-N-[[6-(2-aminophenyl)-3-pyridinyl]methyl]-9-cyclopentylpurine-2,6-diamine (PubChem CID 144680088) has the molecular formula C29H37N9 and a molecular weight of 511.68 g/mol. Its IUPAC name is 2-N-(4-amino-3-methylcyclohexyl)-6-N-[[6-(2-aminophenyl)-3-pyridinyl]methyl]-9-cyclopentylpurine-2,6-diamine.
| Compound Name | 2-N-(4-amino-3-methylcyclohexyl)-6-N-[[6-(2-aminophenyl)-3-pyridinyl]methyl]-9-cyclopentylpurine-2,6-diamine |
|---|---|
| PubChem CID | 144680088 |
| Molecular Formula | C29H37N9 |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | 2-N-(4-amino-3-methylcyclohexyl)-6-N-[[6-(2-aminophenyl)-3-pyridinyl]methyl]-9-cyclopentylpurine-2,6-diamine |
| SMILES | CC1CC(Nc2nc(NCc3ccc(-c4ccccc4N)nc3)c3ncn(C4CCCC4)c3n2)CCC1N |
| InChI | InChI=1S/C29H37N9/c1-18-14-20(11-12-23(18)30)35-29-36-27(26-28(37-29)38(17-34-26)21-6-2-3-7-21)33-16-19-10-13-25(32-15-19)22-8-4-5-9-24(22)31/h4-5,8-10,13,15,17-18,20-21,23H,2-3,6-7,11-12,14,16,30-31H2,1H3,(H2,33,35,36,37) |
| InChIKey | GJNWVZPQNRZXFP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|