C28H34N8O — CID 154065175
2-[5-[[[2-[(2-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]methyl]-2-pyridinyl]phenol (PubChem CID 154065175) has the molecular formula C28H34N8O and a molecular weight of 498.64 g/mol. Its IUPAC name is 2-[5-[[[2-[(2-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]methyl]-2-pyridinyl]phenol.
| Compound Name | 2-[5-[[[2-[(2-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]methyl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 154065175 |
| Molecular Formula | C28H34N8O |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 2-[5-[[[2-[(2-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]methyl]-2-pyridinyl]phenol |
| SMILES | NC1CCCCC1Nc1nc(NCc2ccc(-c3ccccc3O)nc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C28H34N8O/c29-21-10-4-5-11-23(21)33-28-34-26(25-27(35-28)36(17-32-25)19-7-1-2-8-19)31-16-18-13-14-22(30-15-18)20-9-3-6-12-24(20)37/h3,6,9,12-15,17,19,21,23,37H,1-2,4-5,7-8,10-11,16,29H2,(H2,31,33,34,35) |
| InChIKey | ISPJOFRYESUPMA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |