C21H29N7O — CID 118736144
2-[[[2-[[(1R,2R)-2-aminocyclohexyl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenol (PubChem CID 118736144) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[[[2-[[(1R,2R)-2-aminocyclohexyl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenol.
| Compound Name | 2-[[[2-[[(1R,2R)-2-aminocyclohexyl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 118736144 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-[[[2-[[(1R,2R)-2-aminocyclohexyl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]phenol |
| SMILES | CC(C)n1cnc2c(NCc3ccccc3O)nc(N[C@@H]3CCCC[C@H]3N)nc21 |
| InChI | InChI=1S/C21H29N7O/c1-13(2)28-12-24-18-19(23-11-14-7-3-6-10-17(14)29)26-21(27-20(18)28)25-16-9-5-4-8-15(16)22/h3,6-7,10,12-13,15-16,29H,4-5,8-9,11,22H2,1-2H3,(H2,23,25,26,27)/t15-,16-/m1/s1 |
| InChIKey | NJSVKTBHWJBEQS-HZPDHXFCSA-N |
| XLogP | 3.41 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|