C30H38N8O3 — CID 136510967
2-[5-[[[9-cyclopentyl-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]purin-6-yl]amino]methyl]-2-pyridinyl]phenol (PubChem CID 136510967) has the molecular formula C30H38N8O3 and a molecular weight of 558.69 g/mol. Its IUPAC name is 2-[5-[[[9-cyclopentyl-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]purin-6-yl]amino]methyl]-2-pyridinyl]phenol.
| Compound Name | 2-[5-[[[9-cyclopentyl-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]purin-6-yl]amino]methyl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 136510967 |
| Molecular Formula | C30H38N8O3 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 2-[5-[[[9-cyclopentyl-2-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]purin-6-yl]amino]methyl]-2-pyridinyl]phenol |
| SMILES | OCCOCCN1CCN(c2nc(NCc3ccc(-c4ccccc4O)nc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C30H38N8O3/c39-16-18-41-17-15-36-11-13-37(14-12-36)30-34-28(27-29(35-30)38(21-33-27)23-5-1-2-6-23)32-20-22-9-10-25(31-19-22)24-7-3-4-8-26(24)40/h3-4,7-10,19,21,23,39-40H,1-2,5-6,11-18,20H2,(H,32,34,35) |
| InChIKey | KTBKAKUHCLSLRR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|