C30H38N8O2 — CID 90332854
2-[2-[4-[9-cyclopentyl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 90332854) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is 2-[2-[4-[9-cyclopentyl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[9-cyclopentyl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 90332854 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 2-[2-[4-[9-cyclopentyl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | OCCOCCN1CCN(c2nc(NCc3ccc(-c4ccccn4)cc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C30H38N8O2/c39-18-20-40-19-17-36-13-15-37(16-14-36)30-34-28(27-29(35-30)38(22-33-27)25-5-1-2-6-25)32-21-23-8-10-24(11-9-23)26-7-3-4-12-31-26/h3-4,7-12,22,25,39H,1-2,5-6,13-21H2,(H,32,34,35) |
| InChIKey | FAVZXVOYJWNTJL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|