C18H18N6 — CID 24778185
6-(benzylamino)-9-cyclopentylpurine-2-carbonitrile (PubChem CID 24778185) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 6-(benzylamino)-9-cyclopentylpurine-2-carbonitrile.
| Compound Name | 6-(benzylamino)-9-cyclopentylpurine-2-carbonitrile |
|---|---|
| PubChem CID | 24778185 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 6-(benzylamino)-9-cyclopentylpurine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2ccccc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C18H18N6/c19-10-15-22-17(20-11-13-6-2-1-3-7-13)16-18(23-15)24(12-21-16)14-8-4-5-9-14/h1-3,6-7,12,14H,4-5,8-9,11H2,(H,20,22,23) |
| InChIKey | CZGLTILLPOGJQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |