C19H22ClN5 — CID 18473321
2-chloro-9-cyclopentyl-N-(3-phenylpropyl)purin-6-amine (PubChem CID 18473321) has the molecular formula C19H22ClN5 and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-chloro-9-cyclopentyl-N-(3-phenylpropyl)purin-6-amine.
| Compound Name | 2-chloro-9-cyclopentyl-N-(3-phenylpropyl)purin-6-amine |
|---|---|
| PubChem CID | 18473321 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-chloro-9-cyclopentyl-N-(3-phenylpropyl)purin-6-amine |
| SMILES | Clc1nc(NCCCc2ccccc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C19H22ClN5/c20-19-23-17(21-12-6-9-14-7-2-1-3-8-14)16-18(24-19)25(13-22-16)15-10-4-5-11-15/h1-3,7-8,13,15H,4-6,9-12H2,(H,21,23,24) |
| InChIKey | JRSJDDFYXPJLJF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|