C23H29ClN6O5S — CID 24947951
2-amino-4-[[(2S,3S,4R,5R)-5-[2-chloro-6-(3-phenylpropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 24947951) has the molecular formula C23H29ClN6O5S and a molecular weight of 537.04 g/mol. Its IUPAC name is 2-amino-4-[[(2S,3S,4R,5R)-5-[2-chloro-6-(3-phenylpropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[(2S,3S,4R,5R)-5-[2-chloro-6-(3-phenylpropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 24947951 |
| Molecular Formula | C23H29ClN6O5S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 2-amino-4-[[(2S,3S,4R,5R)-5-[2-chloro-6-(3-phenylpropylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | NC(CCSC[C@H]1O[C@@H](n2cnc3c(NCCCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C23H29ClN6O5S/c24-23-28-19(26-9-4-7-13-5-2-1-3-6-13)16-20(29-23)30(12-27-16)21-18(32)17(31)15(35-21)11-36-10-8-14(25)22(33)34/h1-3,5-6,12,14-15,17-18,21,31-32H,4,7-11,25H2,(H,33,34)(H,26,28,29)/t14?,15-,17-,18-,21-/m1/s1 |
| InChIKey | KUKLMZDABSCJPU-BWZSZYTASA-N |
| XLogP | 1.68 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|