C17H23ClN6O5S — CID 87771428
2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-(prop-2-enylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 87771428) has the molecular formula C17H23ClN6O5S and a molecular weight of 458.93 g/mol. Its IUPAC name is 2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-(prop-2-enylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-(prop-2-enylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 87771428 |
| Molecular Formula | C17H23ClN6O5S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-(prop-2-enylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | C=CCNc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CSCCC(N)C(=O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23ClN6O5S/c1-2-4-20-13-10-14(23-17(18)22-13)24(7-21-10)15-12(26)11(25)9(29-15)6-30-5-3-8(19)16(27)28/h2,7-9,11-12,15,25-26H,1,3-6,19H2,(H,27,28)(H,20,22,23)/t8?,9-,11+,12-,15-/m1/s1 |
| InChIKey | JIILRLWYZDSJIN-OVFHZKMJSA-N |
| XLogP | 0.23 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|