C31H34ClN7O6S — CID 87771661
2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 87771661) has the molecular formula C31H34ClN7O6S and a molecular weight of 668.18 g/mol. Its IUPAC name is 2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 87771661 |
| Molecular Formula | C31H34ClN7O6S |
| Molecular Weight | 668.18 g/mol |
| Exact Mass | 667.20 |
| IUPAC Name | 2-amino-4-[[(2S,3R,4R,5R)-5-[2-chloro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | NC(CCSC[C@H]1O[C@@H](n2cnc3c(NCCc4c[nH]c5ccc(OCc6ccccc6)cc45)nc(Cl)nc32)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C31H34ClN7O6S/c32-31-37-27(34-10-8-18-13-35-22-7-6-19(12-20(18)22)44-14-17-4-2-1-3-5-17)24-28(38-31)39(16-36-24)29-26(41)25(40)23(45-29)15-46-11-9-21(33)30(42)43/h1-7,12-13,16,21,23,25-26,29,35,40-41H,8-11,14-15,33H2,(H,42,43)(H,34,37,38)/t21?,23-,25+,26-,29-/m1/s1 |
| InChIKey | ALYHCVQIQWDIOC-RAORGZNESA-N |
| XLogP | 3.35 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|