C22H26N6O3S — CID 118725233
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(1H-indol-3-yl)butylsulfanylmethyl]oxolane-3,4-diol (PubChem CID 118725233) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(1H-indol-3-yl)butylsulfanylmethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(1H-indol-3-yl)butylsulfanylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 118725233 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(1H-indol-3-yl)butylsulfanylmethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCCCCc2c[nH]c3ccccc23)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26N6O3S/c23-20-17-21(26-11-25-20)28(12-27-17)22-19(30)18(29)16(31-22)10-32-8-4-3-5-13-9-24-15-7-2-1-6-14(13)15/h1-2,6-7,9,11-12,16,18-19,22,24,29-30H,3-5,8,10H2,(H2,23,25,26)/t16-,18-,19-,22-/m1/s1 |
| InChIKey | GRICHCCWLMUNBL-WGQQHEPDSA-N |
| XLogP | 2.27 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|