C21H26N6O4S — CID 70677960
5-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-phenylpentanamide (PubChem CID 70677960) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is 5-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-phenylpentanamide.
| Compound Name | 5-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-phenylpentanamide |
|---|---|
| PubChem CID | 70677960 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 5-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-N-phenylpentanamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCCCCC(=O)Nc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H26N6O4S/c22-19-16-20(24-11-23-19)27(12-25-16)21-18(30)17(29)14(31-21)10-32-9-5-4-8-15(28)26-13-6-2-1-3-7-13/h1-3,6-7,11-12,14,17-18,21,29-30H,4-5,8-10H2,(H,26,28)(H2,22,23,24)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | BKKHEFHWVXCOJD-HAXDFEGKSA-N |
| XLogP | 1.57 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|