C15H20F2N6O5S — CID 22826066
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-(difluoromethyl)butanoic acid (PubChem CID 22826066) has the molecular formula C15H20F2N6O5S and a molecular weight of 434.43 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-(difluoromethyl)butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-(difluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 22826066 |
| Molecular Formula | C15H20F2N6O5S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]-2-(difluoromethyl)butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@](N)(C(=O)O)C(F)F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20F2N6O5S/c16-13(17)15(19,14(26)27)1-2-29-3-6-8(24)9(25)12(28-6)23-5-22-7-10(18)20-4-21-11(7)23/h4-6,8-9,12-13,24-25H,1-3,19H2,(H,26,27)(H2,18,20,21)/t6-,8-,9-,12-,15-/m1/s1 |
| InChIKey | FLANYWLDVFEZHP-OEDIOFDVSA-N |
| XLogP | -0.80 |
| TPSA | 182.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|