C25H35N7O4S — CID 67988948
1-[4-[[(2S,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butyl]-3-(4-tert-butylphenyl)urea (PubChem CID 67988948) has the molecular formula C25H35N7O4S and a molecular weight of 529.67 g/mol. Its IUPAC name is 1-[4-[[(2S,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[4-[[(2S,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 67988948 |
| Molecular Formula | C25H35N7O4S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-[4-[[(2S,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCCSC[C@H]2OC(n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C25H35N7O4S/c1-25(2,3)15-6-8-16(9-7-15)31-24(35)27-10-4-5-11-37-12-17-19(33)20(34)23(36-17)32-14-30-18-21(26)28-13-29-22(18)32/h6-9,13-14,17,19-20,23,33-34H,4-5,10-12H2,1-3H3,(H2,26,28,29)(H2,27,31,35)/t17-,19-,20-,23?/m1/s1 |
| InChIKey | BWZWASMUMQLXKE-PSBUXNCMSA-N |
| XLogP | 2.66 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|