C27H37N7O4S — CID 67973642
1-[3-[[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 67973642) has the molecular formula C27H37N7O4S and a molecular weight of 555.71 g/mol. Its IUPAC name is 1-[3-[[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 67973642 |
| Molecular Formula | C27H37N7O4S |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 1-[3-[[(3aR,4R,6S,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](CSCCCNC(=O)Nc1ccc(C(C)(C)C)cc1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C27H37N7O4S/c1-26(2,3)16-7-9-17(10-8-16)33-25(35)29-11-6-12-39-13-18-20-21(38-27(4,5)37-20)24(36-18)34-15-32-19-22(28)30-14-31-23(19)34/h7-10,14-15,18,20-21,24H,6,11-13H2,1-5H3,(H2,28,30,31)(H2,29,33,35)/t18-,20+,21-,24-/m1/s1 |
| InChIKey | VNMDKQVHQYKEAN-LOCCHRAXSA-N |
| XLogP | 4.07 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|