C18H25N5O5S — CID 10574293
methyl 4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]butanoate (PubChem CID 10574293) has the molecular formula C18H25N5O5S and a molecular weight of 423.50 g/mol. Its IUPAC name is methyl 4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]butanoate.
| Compound Name | methyl 4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 10574293 |
| Molecular Formula | C18H25N5O5S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | methyl 4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]butanoate |
| SMILES | COC(=O)CCCSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H25N5O5S/c1-18(2)27-13-10(7-29-6-4-5-11(24)25-3)26-17(14(13)28-18)23-9-22-12-15(19)20-8-21-16(12)23/h8-10,13-14,17H,4-7H2,1-3H3,(H2,19,20,21)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | FMCHAOUFWYCCLK-IWCJZZDYSA-N |
| XLogP | 1.51 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|