C19H26N6O5S — CID 139368639
(2R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]piperidine-2-carboxylic acid (PubChem CID 139368639) has the molecular formula C19H26N6O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is (2R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]piperidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 139368639 |
| Molecular Formula | C19H26N6O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (2R,4R)-4-[[(3aR,4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]piperidine-2-carboxylic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CS[C@@H]1CCN[C@@H](C(=O)O)C1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C19H26N6O5S/c1-19(2)29-13-11(6-31-9-3-4-21-10(5-9)18(26)27)28-17(14(13)30-19)25-8-24-12-15(20)22-7-23-16(12)25/h7-11,13-14,17,21H,3-6H2,1-2H3,(H,26,27)(H2,20,22,23)/t9-,10-,11-,13-,14-,17-/m1/s1 |
| InChIKey | XJWJYXIWUGKYKZ-MGHJIYOTSA-N |
| XLogP | 0.76 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |