C33H44N8O5 — CID 163604895
1-[(4S)-4-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-tert-butylphenyl)urea (PubChem CID 163604895) has the molecular formula C33H44N8O5 and a molecular weight of 632.77 g/mol. Its IUPAC name is 1-[(4S)-4-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[(4S)-4-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 163604895 |
| Molecular Formula | C33H44N8O5 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 1-[(4S)-4-[[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCC[C@H](CNCc2ccccc2O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C33H44N8O5/c1-33(2,3)22-10-12-23(13-11-22)40-32(45)36-14-6-7-20(16-35-17-21-8-4-5-9-24(21)42)15-25-27(43)28(44)31(46-25)41-19-39-26-29(34)37-18-38-30(26)41/h4-5,8-13,18-20,25,27-28,31,35,42-44H,6-7,14-17H2,1-3H3,(H2,34,37,38)(H2,36,40,45)/t20-,25+,27-,28-,31+/m0/s1 |
| InChIKey | HAXCAQLLFBNOAU-QHZKRUETSA-N |
| XLogP | 3.43 |
| TPSA | 192.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|