C33H44N8O5 — CID 129069774
1-[(4S)-4-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-butylphenyl)urea (PubChem CID 129069774) has the molecular formula C33H44N8O5 and a molecular weight of 632.77 g/mol. Its IUPAC name is 1-[(4S)-4-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-butylphenyl)urea.
| Compound Name | 1-[(4S)-4-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-butylphenyl)urea |
|---|---|
| PubChem CID | 129069774 |
| Molecular Formula | C33H44N8O5 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 1-[(4S)-4-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-5-[(2-hydroxyphenyl)methylamino]pentyl]-3-(4-butylphenyl)urea |
| SMILES | CCCCc1ccc(NC(=O)NCCC[C@H](CNCc2ccccc2O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](O)C2O)cc1 |
| InChI | InChI=1S/C33H44N8O5/c1-2-3-7-21-11-13-24(14-12-21)40-33(45)36-15-6-8-22(17-35-18-23-9-4-5-10-25(23)42)16-26-28(43)29(44)32(46-26)41-20-39-27-30(34)37-19-38-31(27)41/h4-5,9-14,19-20,22,26,28-29,32,35,42-44H,2-3,6-8,15-18H2,1H3,(H2,34,37,38)(H2,36,40,45)/t22-,26+,28?,29-,32+/m0/s1 |
| InChIKey | LLMOSMQZTDJCQW-OGFLQXNKSA-N |
| XLogP | 3.47 |
| TPSA | 192.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|