C25H36N8O4 — CID 67973951
1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(3-ethylphenyl)urea (PubChem CID 67973951) has the molecular formula C25H36N8O4 and a molecular weight of 512.62 g/mol. Its IUPAC name is 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(3-ethylphenyl)urea.
| Compound Name | 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(3-ethylphenyl)urea |
|---|---|
| PubChem CID | 67973951 |
| Molecular Formula | C25H36N8O4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 1-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(3-ethylphenyl)urea |
| SMILES | CCc1cccc(NC(=O)NCCCN(C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@H]2O)C(C)C)c1 |
| InChI | InChI=1S/C25H36N8O4/c1-4-16-7-5-8-17(11-16)31-25(36)27-9-6-10-32(15(2)3)12-18-20(34)21(35)24(37-18)33-14-30-19-22(26)28-13-29-23(19)33/h5,7-8,11,13-15,18,20-21,24,34-35H,4,6,9-10,12H2,1-3H3,(H2,26,28,29)(H2,27,31,36)/t18-,20+,21-,24-/m1/s1 |
| InChIKey | CQOWJFKBLYCKMN-LOCCHRAXSA-N |
| XLogP | 1.51 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|