C22H30N8O4 — CID 67988971
1-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]ethyl]-3-[(3-methylphenyl)methyl]urea (PubChem CID 67988971) has the molecular formula C22H30N8O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]ethyl]-3-[(3-methylphenyl)methyl]urea.
| Compound Name | 1-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]ethyl]-3-[(3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 67988971 |
| Molecular Formula | C22H30N8O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 1-[2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]ethyl]-3-[(3-methylphenyl)methyl]urea |
| SMILES | Cc1cccc(CNC(=O)NCCN(C)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C22H30N8O4/c1-13-4-3-5-14(8-13)9-25-22(33)24-6-7-29(2)10-15-17(31)18(32)21(34-15)30-12-28-16-19(23)26-11-27-20(16)30/h3-5,8,11-12,15,17-18,21,31-32H,6-7,9-10H2,1-2H3,(H2,23,26,27)(H2,24,25,33)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | YQNIFPIZTQCTRA-QTQZEZTPSA-N |
| XLogP | -0.23 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |