C20H26FN7O3 — CID 130214884
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[(4-fluorophenyl)methylamino]ethyl-methylamino]methyl]oxolane-3,4-diol (PubChem CID 130214884) has the molecular formula C20H26FN7O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[(4-fluorophenyl)methylamino]ethyl-methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[(4-fluorophenyl)methylamino]ethyl-methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130214884 |
| Molecular Formula | C20H26FN7O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-[(4-fluorophenyl)methylamino]ethyl-methylamino]methyl]oxolane-3,4-diol |
| SMILES | CN(CCNCc1ccc(F)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H26FN7O3/c1-27(7-6-23-8-12-2-4-13(21)5-3-12)9-14-16(29)17(30)20(31-14)28-11-26-15-18(22)24-10-25-19(15)28/h2-5,10-11,14,16-17,20,23,29-30H,6-9H2,1H3,(H2,22,24,25)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | XGBJOXKAMMIPGZ-WVSUBDOOSA-N |
| XLogP | -0.11 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|