C16H27N7O4 — CID 130214929
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-(2-methoxyethylamino)ethyl-methylamino]methyl]oxolane-3,4-diol (PubChem CID 130214929) has the molecular formula C16H27N7O4 and a molecular weight of 381.44 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-(2-methoxyethylamino)ethyl-methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-(2-methoxyethylamino)ethyl-methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 130214929 |
| Molecular Formula | C16H27N7O4 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[2-(2-methoxyethylamino)ethyl-methylamino]methyl]oxolane-3,4-diol |
| SMILES | COCCNCCN(C)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H27N7O4/c1-22(5-3-18-4-6-26-2)7-10-12(24)13(25)16(27-10)23-9-21-11-14(17)19-8-20-15(11)23/h8-10,12-13,16,18,24-25H,3-7H2,1-2H3,(H2,17,19,20)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | SNNVBQHDBZLILN-XNIJJKJLSA-N |
| XLogP | -1.80 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|