C26H36N8O6 — CID 67973712
butyl 4-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propylcarbamoylamino]benzoate (PubChem CID 67973712) has the molecular formula C26H36N8O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is butyl 4-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propylcarbamoylamino]benzoate.
| Compound Name | butyl 4-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 67973712 |
| Molecular Formula | C26H36N8O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | butyl 4-[3-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propylcarbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)NCCCN(C)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H36N8O6/c1-3-4-12-39-25(37)16-6-8-17(9-7-16)32-26(38)28-10-5-11-33(2)13-18-20(35)21(36)24(40-18)34-15-31-19-22(27)29-14-30-23(19)34/h6-9,14-15,18,20-21,24,35-36H,3-5,10-13H2,1-2H3,(H2,27,29,30)(H2,28,32,38)/t18-,20+,21-,24-/m1/s1 |
| InChIKey | XOEAVTJSQUMFPU-LOCCHRAXSA-N |
| XLogP | 1.13 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|