C25H36N8O4 — CID 126709532
1-[3-[[(2R,3S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 126709532) has the molecular formula C25H36N8O4 and a molecular weight of 512.62 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 126709532 |
| Molecular Formula | C25H36N8O4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 1-[3-[[(2R,3S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2ncc3c(N)ncnc32)C(O)[C@@H]1O |
| InChI | InChI=1S/C25H36N8O4/c1-25(2,3)15-6-8-16(9-7-15)31-24(36)27-10-5-11-32(4)13-18-19(34)20(35)23(37-18)33-22-17(12-30-33)21(26)28-14-29-22/h6-9,12,14,18-20,23,34-35H,5,10-11,13H2,1-4H3,(H2,26,28,29)(H2,27,31,36)/t18-,19-,20?,23-/m1/s1 |
| InChIKey | DXZBRMRRUVZFTF-ITIAZEQMSA-N |
| XLogP | 1.47 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|