C25H34N8O5 — CID 67973266
N-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[(4-tert-butylphenyl)carbamoylamino]-N-methylpropanamide (PubChem CID 67973266) has the molecular formula C25H34N8O5 and a molecular weight of 526.60 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[(4-tert-butylphenyl)carbamoylamino]-N-methylpropanamide.
| Compound Name | N-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[(4-tert-butylphenyl)carbamoylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 67973266 |
| Molecular Formula | C25H34N8O5 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | N-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3-[(4-tert-butylphenyl)carbamoylamino]-N-methylpropanamide |
| SMILES | CN(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@H]1O)C(=O)CCNC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34N8O5/c1-25(2,3)14-5-7-15(8-6-14)31-24(37)27-10-9-17(34)32(4)11-16-19(35)20(36)23(38-16)33-13-30-18-21(26)28-12-29-22(18)33/h5-8,12-13,16,19-20,23,35-36H,9-11H2,1-4H3,(H2,26,28,29)(H2,27,31,37)/t16-,19+,20-,23-/m1/s1 |
| InChIKey | VIBHWCMJWZAGOB-YPHICONVSA-N |
| XLogP | 1.00 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |